C24H29ClN6O6 — CID 156862499
6-[5-[2-[[3-[(2R)-2-amino-3-hydroxypropoxy]-4-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 156862499) has the molecular formula C24H29ClN6O6 and a molecular weight of 532.99 g/mol. Its IUPAC name is 6-[5-[2-[[3-[(2R)-2-amino-3-hydroxypropoxy]-4-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-[2-[[3-[(2R)-2-amino-3-hydroxypropoxy]-4-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156862499 |
| Molecular Formula | C24H29ClN6O6 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 6-[5-[2-[[3-[(2R)-2-amino-3-hydroxypropoxy]-4-chloro-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | N[C@H](CO)COc1ncc2c(c1Cl)CC(CNCCC1CN(c3ccc4c(n3)NC(=O)CO4)C(=O)O1)C2 |
| InChI | InChI=1S/C24H29ClN6O6/c25-21-17-6-13(5-14(17)8-28-23(21)36-11-15(26)10-32)7-27-4-3-16-9-31(24(34)37-16)19-2-1-18-22(29-19)30-20(33)12-35-18/h1-2,8,13,15-16,27,32H,3-7,9-12,26H2,(H,29,30,33)/t13?,15-,16?/m1/s1 |
| InChIKey | CWDVMPVKEWBLIG-OGVSOVDVSA-N |
| XLogP | 0.88 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|