C28H35FN6O6 — CID 156862685
tert-butyl N-[[5-[2-[(4-fluoro-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl]carbamate (PubChem CID 156862685) has the molecular formula C28H35FN6O6 and a molecular weight of 570.62 g/mol. Its IUPAC name is tert-butyl N-[[5-[2-[(4-fluoro-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[2-[(4-fluoro-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 156862685 |
| Molecular Formula | C28H35FN6O6 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | tert-butyl N-[[5-[2-[(4-fluoro-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridin-6-yl)methylamino]ethyl]-2-oxo-3-(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]methyl]carbamate |
| SMILES | Cc1ncc(F)c2c1CC(CNCCC1(CNC(=O)OC(C)(C)C)CN(c3ccc4c(n3)NC(=O)CO4)C(=O)O1)C2 |
| InChI | InChI=1S/C28H35FN6O6/c1-16-18-9-17(10-19(18)20(29)12-31-16)11-30-8-7-28(14-32-25(37)40-27(2,3)4)15-35(26(38)41-28)22-6-5-21-24(33-22)34-23(36)13-39-21/h5-6,12,17,30H,7-11,13-15H2,1-4H3,(H,32,37)(H,33,34,36) |
| InChIKey | JGOVRGYLDWUBHP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|