C13H22N2OS — CID 156863384
N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-[(2-methylpropan-2-yl)oxyamino]ethanethioamide (PubChem CID 156863384) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-[(2-methylpropan-2-yl)oxyamino]ethanethioamide.
| Compound Name | N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-[(2-methylpropan-2-yl)oxyamino]ethanethioamide |
|---|---|
| PubChem CID | 156863384 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-[(2-methylpropan-2-yl)oxyamino]ethanethioamide |
| SMILES | C=C(/C=C\C=C/C)NC(=S)CNOC(C)(C)C |
| InChI | InChI=1S/C13H22N2OS/c1-6-7-8-9-11(2)15-12(17)10-14-16-13(3,4)5/h6-9,14H,2,10H2,1,3-5H3,(H,15,17)/b7-6-,9-8- |
| InChIKey | JOYLERWWBBSIJZ-JPDBVBESSA-N |
| XLogP | 2.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|