C23H23N7O3 — CID 156863675
5-amino-8-(1,5-dimethyl-6-oxo-3-pyridinyl)-7-[(3E)-hexa-1,3,5-trien-3-yl]-2-[(5-methyl-1,3-oxazol-4-yl)methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 156863675) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 5-amino-8-(1,5-dimethyl-6-oxo-3-pyridinyl)-7-[(3E)-hexa-1,3,5-trien-3-yl]-2-[(5-methyl-1,3-oxazol-4-yl)methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-amino-8-(1,5-dimethyl-6-oxo-3-pyridinyl)-7-[(3E)-hexa-1,3,5-trien-3-yl]-2-[(5-methyl-1,3-oxazol-4-yl)methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 156863675 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 5-amino-8-(1,5-dimethyl-6-oxo-3-pyridinyl)-7-[(3E)-hexa-1,3,5-trien-3-yl]-2-[(5-methyl-1,3-oxazol-4-yl)methyl]-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | C=C/C=C(\C=C)c1nc(N)n2c(=O)n(Cc3ncoc3C)nc2c1-c1cc(C)c(=O)n(C)c1 |
| InChI | InChI=1S/C23H23N7O3/c1-6-8-15(7-2)19-18(16-9-13(3)21(31)28(5)10-16)20-27-29(11-17-14(4)33-12-25-17)23(32)30(20)22(24)26-19/h6-10,12H,1-2,11H2,3-5H3,(H2,24,26)/b15-8+ |
| InChIKey | JPUAHPZBSVWBAB-OVCLIPMQSA-N |
| XLogP | 2.25 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|