C20H16F4N6O2 — CID 156863786
5-amino-7-(4-fluorophenyl)-8-(5-methyl-6-oxo-1H-pyridin-3-yl)-2-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 156863786) has the molecular formula C20H16F4N6O2 and a molecular weight of 448.38 g/mol. Its IUPAC name is 5-amino-7-(4-fluorophenyl)-8-(5-methyl-6-oxo-1H-pyridin-3-yl)-2-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-amino-7-(4-fluorophenyl)-8-(5-methyl-6-oxo-1H-pyridin-3-yl)-2-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 156863786 |
| Molecular Formula | C20H16F4N6O2 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 5-amino-7-(4-fluorophenyl)-8-(5-methyl-6-oxo-1H-pyridin-3-yl)-2-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1cc(-c2c(-c3ccc(F)cc3)nc(N)n3c(=O)n(CCC(F)(F)F)nc23)c[nH]c1=O |
| InChI | InChI=1S/C20H16F4N6O2/c1-10-8-12(9-26-17(10)31)14-15(11-2-4-13(21)5-3-11)27-18(25)30-16(14)28-29(19(30)32)7-6-20(22,23)24/h2-5,8-9H,6-7H2,1H3,(H2,25,27)(H,26,31) |
| InChIKey | RJNUBAMUDBNWQF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |