About methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate
methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate (PubChem CID 156864542) has the molecular formula C23H32N2O3
and a molecular weight of 384.52 g/mol. Its IUPAC name is methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate |
| PubChem CID | 156864542 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate |
| SMILES | COC(=O)NC1CC(C(=O)N2CCC3(CC2)CC(c2ccc(C)cc2C)C3)C1 |
| InChI | InChI=1S/C23H32N2O3/c1-15-4-5-20(16(2)10-15)18-13-23(14-18)6-8-25(9-7-23)21(26)17-11-19(12-17)24-22(27)28-3/h4-5,10,17-19H,6-9,11-14H2,1-3H3,(H,24,27) |
| InChIKey | VXCQCOOVZKJQNY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The IUPAC name of methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate (CID 156864542) is methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate.
What is the SMILES notation for methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The canonical SMILES for methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate is COC(=O)NC1CC(C(=O)N2CCC3(CC2)CC(c2ccc(C)cc2C)C3)C1.
What is the InChIKey of methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
The InChIKey is VXCQCOOVZKJQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O3/c1-15-4-5-20(16(2)10-15)18-13-23(14-18)6-8-25(9-7-23)21(26)17-11-19(12-17)24-22(27)28-3/h4-5,10,17-19H,6-9,11-14H2,1-3H3,(H,24,27).
What are the key properties of methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate?
methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate has a molecular weight of 384.52 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-[2-(2,4-dimethylphenyl)-7-azaspiro[3.5]nonane-7-carbonyl]cyclobutyl]carbamate is sourced from PubChem (CID 156864542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).