About methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate
methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate (PubChem CID 156864548) has the molecular formula C22H35N3O4
and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate |
| PubChem CID | 156864548 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC)C(=O)N1CCC2(CC1)CC(c1nc(C(C)(C)C)co1)C2 |
| InChI | InChI=1S/C22H35N3O4/c1-6-15(13-23-20(27)28-5)19(26)25-9-7-22(8-10-25)11-16(12-22)18-24-17(14-29-18)21(2,3)4/h14-16H,6-13H2,1-5H3,(H,23,27) |
| InChIKey | NVWKWQRIHZJQRV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate?
The IUPAC name of methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate (CID 156864548) is methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate.
What is the SMILES notation for methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate?
The canonical SMILES for methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate is CCC(CNC(=O)OC)C(=O)N1CCC2(CC1)CC(c1nc(C(C)(C)C)co1)C2.
What is the InChIKey of methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate?
The InChIKey is NVWKWQRIHZJQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35N3O4/c1-6-15(13-23-20(27)28-5)19(26)25-9-7-22(8-10-25)11-16(12-22)18-24-17(14-29-18)21(2,3)4/h14-16H,6-13H2,1-5H3,(H,23,27).
What are the key properties of methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate?
methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate has a molecular weight of 405.54 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[2-(4-tert-butyl-1,3-oxazol-2-yl)-7-azaspiro[3.5]nonane-7-carbonyl]butyl]carbamate is sourced from PubChem (CID 156864548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).