C7H7F3N2O4 — CID 156864838
1-(2,2-dihydroxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 156864838) has the molecular formula C7H7F3N2O4 and a molecular weight of 240.14 g/mol. Its IUPAC name is 1-(2,2-dihydroxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,2-dihydroxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156864838 |
| Molecular Formula | C7H7F3N2O4 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-(2,2-dihydroxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CC(O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O4/c8-7(9,10)3-1-12(2-4(13)14)6(16)11-5(3)15/h1,4,13-14H,2H2,(H,11,15,16) |
| InChIKey | RMOQXUGAEGTEPH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|