C11H15F3N2O4 — CID 156864867
1-(2,2-diethoxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 156864867) has the molecular formula C11H15F3N2O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2,2-diethoxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156864867 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-5-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CCOC(Cn1cc(C(F)(F)F)c(=O)[nH]c1=O)OCC |
| InChI | InChI=1S/C11H15F3N2O4/c1-3-19-8(20-4-2)6-16-5-7(11(12,13)14)9(17)15-10(16)18/h5,8H,3-4,6H2,1-2H3,(H,15,17,18) |
| InChIKey | PMZFTGQSJVRLJE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|