C26H56O4S2Si2 — CID 15686520
tributyl-(1,1,3,3-tetraoxo-4-tributylsilyl-1,3-dithietan-2-yl)silane (PubChem CID 15686520) has the molecular formula C26H56O4S2Si2 and a molecular weight of 553.04 g/mol. Its IUPAC name is tributyl-(1,1,3,3-tetraoxo-4-tributylsilyl-1,3-dithietan-2-yl)silane.
| Compound Name | tributyl-(1,1,3,3-tetraoxo-4-tributylsilyl-1,3-dithietan-2-yl)silane |
|---|---|
| PubChem CID | 15686520 |
| Molecular Formula | C26H56O4S2Si2 |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | tributyl-(1,1,3,3-tetraoxo-4-tributylsilyl-1,3-dithietan-2-yl)silane |
| SMILES | CCCC[Si](CCCC)(CCCC)C1S(=O)(=O)C([Si](CCCC)(CCCC)CCCC)S1(=O)=O |
| InChI | InChI=1S/C26H56O4S2Si2/c1-7-13-19-33(20-14-8-2,21-15-9-3)25-31(27,28)26(32(25,29)30)34(22-16-10-4,23-17-11-5)24-18-12-6/h25-26H,7-24H2,1-6H3 |
| InChIKey | AZEZBYNTYJCZBV-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|