C25H26ClN7O2 — CID 156865497
N-[(3-aminophenyl)methyl]-4-[[5-chloro-4-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-methoxybenzamide (PubChem CID 156865497) has the molecular formula C25H26ClN7O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-4-[[5-chloro-4-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-methoxybenzamide.
| Compound Name | N-[(3-aminophenyl)methyl]-4-[[5-chloro-4-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 156865497 |
| Molecular Formula | C25H26ClN7O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-4-[[5-chloro-4-(1-propan-2-ylpyrazol-4-yl)pyrimidin-2-yl]amino]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2cccc(N)c2)ccc1Nc1ncc(Cl)c(-c2cnn(C(C)C)c2)n1 |
| InChI | InChI=1S/C25H26ClN7O2/c1-15(2)33-14-18(12-30-33)23-20(26)13-29-25(32-23)31-21-8-7-17(10-22(21)35-3)24(34)28-11-16-5-4-6-19(27)9-16/h4-10,12-15H,11,27H2,1-3H3,(H,28,34)(H,29,31,32) |
| InChIKey | YVMQOFARFSHFFP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|