C13H15NO2S — CID 15686550
5-benzyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole 2,2-dioxide (PubChem CID 15686550) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 5-benzyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole 2,2-dioxide.
| Compound Name | 5-benzyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole 2,2-dioxide |
|---|---|
| PubChem CID | 15686550 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5-benzyl-1,3,4,6-tetrahydrothieno[3,4-c]pyrrole 2,2-dioxide |
| SMILES | O=S1(=O)CC2=C(CN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C13H15NO2S/c15-17(16)9-12-7-14(8-13(12)10-17)6-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | MUYCCLDKHCAJHV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|