About 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide
3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide (PubChem CID 15686556) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide.
Molecular Properties
| Compound Name | 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide |
| PubChem CID | 15686556 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide |
| SMILES | O=S1(=O)Cc2c[nH]cc2C1 |
| InChI | InChI=1S/C6H7NO2S/c8-10(9)3-5-1-7-2-6(5)4-10/h1-2,7H,3-4H2 |
| InChIKey | SQBIKFLDAFKKSZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide?
The IUPAC name of 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide (CID 15686556) is 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide.
What is the SMILES notation for 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide?
The canonical SMILES for 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide is O=S1(=O)Cc2c[nH]cc2C1.
What is the InChIKey of 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide?
The InChIKey is SQBIKFLDAFKKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c8-10(9)3-5-1-7-2-6(5)4-10/h1-2,7H,3-4H2.
What are the key properties of 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide?
3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide has a molecular weight of 157.19 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-1H-thieno[3,4-c]pyrrole 2,2-dioxide is sourced from PubChem (CID 15686556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).