C15H21F2NO2 — CID 156865624
ethyl 3-[benzyl(propan-2-yl)amino]-2,2-difluoropropanoate (PubChem CID 156865624) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is ethyl 3-[benzyl(propan-2-yl)amino]-2,2-difluoropropanoate.
| Compound Name | ethyl 3-[benzyl(propan-2-yl)amino]-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 156865624 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl 3-[benzyl(propan-2-yl)amino]-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CN(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C15H21F2NO2/c1-4-20-14(19)15(16,17)11-18(12(2)3)10-13-8-6-5-7-9-13/h5-9,12H,4,10-11H2,1-3H3 |
| InChIKey | MDWRURZGZITUEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |