C20H41N3O2 — CID 156866564
ethane;2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]acetamide (PubChem CID 156866564) has the molecular formula C20H41N3O2 and a molecular weight of 355.57 g/mol. Its IUPAC name is ethane;2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]acetamide.
| Compound Name | ethane;2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 156866564 |
| Molecular Formula | C20H41N3O2 |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | ethane;2-[methyl-[2-[methyl-[3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypropyl]amino]ethyl]amino]acetamide |
| SMILES | C=C(C)/C=C\C(=C)OCCCN(C)CCN(C)CC(N)=O.CC.CC |
| InChI | InChI=1S/C16H29N3O2.2C2H6/c1-14(2)7-8-15(3)21-12-6-9-18(4)10-11-19(5)13-16(17)20;2*1-2/h7-8H,1,3,6,9-13H2,2,4-5H3,(H2,17,20);2*1-2H3/b8-7-;; |
| InChIKey | MGGWLNXRUNHVET-OTMFCZTRSA-N |
| XLogP | 3.44 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|