C24H45N5O — CID 156866746
(2S,6R)-2,6-dimethyl-1-[2-(2-piperazin-1-ylethoxy)ethyl]-4-(4-propan-2-yl-2-pyridinyl)piperazine;ethane (PubChem CID 156866746) has the molecular formula C24H45N5O and a molecular weight of 419.66 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-1-[2-(2-piperazin-1-ylethoxy)ethyl]-4-(4-propan-2-yl-2-pyridinyl)piperazine;ethane.
| Compound Name | (2S,6R)-2,6-dimethyl-1-[2-(2-piperazin-1-ylethoxy)ethyl]-4-(4-propan-2-yl-2-pyridinyl)piperazine;ethane |
|---|---|
| PubChem CID | 156866746 |
| Molecular Formula | C24H45N5O |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.36 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-1-[2-(2-piperazin-1-ylethoxy)ethyl]-4-(4-propan-2-yl-2-pyridinyl)piperazine;ethane |
| SMILES | CC.CC(C)c1ccnc(N2C[C@@H](C)N(CCOCCN3CCNCC3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C22H39N5O.C2H6/c1-18(2)21-5-6-24-22(15-21)26-16-19(3)27(20(4)17-26)12-14-28-13-11-25-9-7-23-8-10-25;1-2/h5-6,15,18-20,23H,7-14,16-17H2,1-4H3;1-2H3/t19-,20+; |
| InChIKey | ATYUQYLCFWWPQT-AMDBCLDASA-N |
| XLogP | 3.05 |
| TPSA | 43.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|