About ethane;propane;4-pyrrolidin-1-ylpyrimidine
ethane;propane;4-pyrrolidin-1-ylpyrimidine (PubChem CID 156866865) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;propane;4-pyrrolidin-1-ylpyrimidine.
Molecular Properties
| Compound Name | ethane;propane;4-pyrrolidin-1-ylpyrimidine |
| PubChem CID | 156866865 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | ethane;propane;4-pyrrolidin-1-ylpyrimidine |
| SMILES | CC.CCC.c1cc(N2CCCC2)ncn1 |
| InChI | InChI=1S/C8H11N3.C3H8.C2H6/c1-2-6-11(5-1)8-3-4-9-7-10-8;1-3-2;1-2/h3-4,7H,1-2,5-6H2;3H2,1-2H3;1-2H3 |
| InChIKey | VVTPVGFFUIPTQN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;propane;4-pyrrolidin-1-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;4-pyrrolidin-1-ylpyrimidine?
The IUPAC name of ethane;propane;4-pyrrolidin-1-ylpyrimidine (CID 156866865) is ethane;propane;4-pyrrolidin-1-ylpyrimidine.
What is the SMILES notation for ethane;propane;4-pyrrolidin-1-ylpyrimidine?
The canonical SMILES for ethane;propane;4-pyrrolidin-1-ylpyrimidine is CC.CCC.c1cc(N2CCCC2)ncn1.
What is the InChIKey of ethane;propane;4-pyrrolidin-1-ylpyrimidine?
The InChIKey is VVTPVGFFUIPTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3.C3H8.C2H6/c1-2-6-11(5-1)8-3-4-9-7-10-8;1-3-2;1-2/h3-4,7H,1-2,5-6H2;3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;4-pyrrolidin-1-ylpyrimidine?
ethane;propane;4-pyrrolidin-1-ylpyrimidine has a molecular weight of 223.36 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;4-pyrrolidin-1-ylpyrimidine is sourced from PubChem (CID 156866865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).