C21H33N3O2W — CID 156866932
carbanide;(2E,4E)-2-ethenyl-5-methyl-9-[8-(2-oxoethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]nona-2,4-dienamide;tungsten(2+) (PubChem CID 156866932) has the molecular formula C21H33N3O2W and a molecular weight of 543.35 g/mol. Its IUPAC name is carbanide;(2E,4E)-2-ethenyl-5-methyl-9-[8-(2-oxoethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]nona-2,4-dienamide;tungsten(2+).
| Compound Name | carbanide;(2E,4E)-2-ethenyl-5-methyl-9-[8-(2-oxoethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]nona-2,4-dienamide;tungsten(2+) |
|---|---|
| PubChem CID | 156866932 |
| Molecular Formula | C21H33N3O2W |
| Molecular Weight | 543.35 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | carbanide;(2E,4E)-2-ethenyl-5-methyl-9-[8-(2-oxoethyl)-3,8-diazabicyclo[3.2.1]octan-3-yl]nona-2,4-dienamide;tungsten(2+) |
| SMILES | C=C/C(=C\C=C(/C)CCCCN1CC2CCC(C1)N2C[C-]=O)C(N)=O.[CH3-].[W+2] |
| InChI | InChI=1S/C20H30N3O2.CH3.W/c1-3-17(20(21)25)8-7-16(2)6-4-5-11-22-14-18-9-10-19(15-22)23(18)12-13-24;;/h3,7-8,18-19H,1,4-6,9-12,14-15H2,2H3,(H2,21,25);1H3;/q2*-1;+2/b16-7+,17-8+;; |
| InChIKey | HNWMZSABJUNUFF-CVTGKVSLSA-N |
| XLogP | 2.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|