About methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene
methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene (PubChem CID 156867170) has the molecular formula C19H41N3O
and a molecular weight of 327.56 g/mol. Its IUPAC name is methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene.
Molecular Properties
| Compound Name | methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene |
| PubChem CID | 156867170 |
| Molecular Formula | C19H41N3O |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.32 |
| IUPAC Name | methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene |
| SMILES | C.C=CC.CC(C)OCCN1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C15H31N3O.C3H6.CH4/c1-14(2)19-12-11-17-7-9-18(10-8-17)13-15-3-5-16-6-4-15;1-3-2;/h14-16H,3-13H2,1-2H3;3H,1H2,2H3;1H4 |
| InChIKey | BVQSSFKWJBPSDX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene?
The IUPAC name of methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene (CID 156867170) is methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene.
What is the SMILES notation for methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene?
The canonical SMILES for methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene is C.C=CC.CC(C)OCCN1CCN(CC2CCNCC2)CC1.
What is the InChIKey of methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene?
The InChIKey is BVQSSFKWJBPSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O.C3H6.CH4/c1-14(2)19-12-11-17-7-9-18(10-8-17)13-15-3-5-16-6-4-15;1-3-2;/h14-16H,3-13H2,1-2H3;3H,1H2,2H3;1H4.
What are the key properties of methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene?
methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene has a molecular weight of 327.56 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(piperidin-4-ylmethyl)-4-(2-propan-2-yloxyethyl)piperazine;prop-1-ene is sourced from PubChem (CID 156867170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).