C14H22N2O5 — CID 156867578
(3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(prop-2-enoylamino)piperidine-3-carboxylic acid (PubChem CID 156867578) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(prop-2-enoylamino)piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(prop-2-enoylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 156867578 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (3R,5S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(prop-2-enoylamino)piperidine-3-carboxylic acid |
| SMILES | C=CC(=O)N[C@H]1C[C@@H](C(=O)O)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H22N2O5/c1-5-11(17)15-10-6-9(12(18)19)7-16(8-10)13(20)21-14(2,3)4/h5,9-10H,1,6-8H2,2-4H3,(H,15,17)(H,18,19)/t9-,10+/m1/s1 |
| InChIKey | JPKROVAJFWBYRM-ZJUUUORDSA-N |
| XLogP | 1.00 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|