C10H20NO+ — CID 156867604
1-[(3S)-1,3-dimethylpiperidin-1-ium-1-yl]prop-2-en-1-ol (PubChem CID 156867604) has the molecular formula C10H20NO+ and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-[(3S)-1,3-dimethylpiperidin-1-ium-1-yl]prop-2-en-1-ol.
| Compound Name | 1-[(3S)-1,3-dimethylpiperidin-1-ium-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 156867604 |
| Molecular Formula | C10H20NO+ |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 1-[(3S)-1,3-dimethylpiperidin-1-ium-1-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)[N+]1(C)CCC[C@H](C)C1 |
| InChI | InChI=1S/C10H20NO/c1-4-10(12)11(3)7-5-6-9(2)8-11/h4,9-10,12H,1,5-8H2,2-3H3/q+1/t9-,10?,11?/m0/s1 |
| InChIKey | HGUBYVZWBGTOLG-WHXUTIOJSA-N |
| XLogP | 1.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|