C30H56O6 — CID 156867622
ethane;methanol;(5E,7E,10R,12R,14R)-6,10,14-trimethyl-4-[(6-methyloxan-2-yl)oxymethyl]-12-propyl-1,2-dioxacyclohexadeca-5,7-dien-9-one (PubChem CID 156867622) has the molecular formula C30H56O6 and a molecular weight of 512.77 g/mol. Its IUPAC name is ethane;methanol;(5E,7E,10R,12R,14R)-6,10,14-trimethyl-4-[(6-methyloxan-2-yl)oxymethyl]-12-propyl-1,2-dioxacyclohexadeca-5,7-dien-9-one.
| Compound Name | ethane;methanol;(5E,7E,10R,12R,14R)-6,10,14-trimethyl-4-[(6-methyloxan-2-yl)oxymethyl]-12-propyl-1,2-dioxacyclohexadeca-5,7-dien-9-one |
|---|---|
| PubChem CID | 156867622 |
| Molecular Formula | C30H56O6 |
| Molecular Weight | 512.77 g/mol |
| Exact Mass | 512.41 |
| IUPAC Name | ethane;methanol;(5E,7E,10R,12R,14R)-6,10,14-trimethyl-4-[(6-methyloxan-2-yl)oxymethyl]-12-propyl-1,2-dioxacyclohexadeca-5,7-dien-9-one |
| SMILES | CC.CCC[C@@H]1C[C@@H](C)CCOOCC(COC2CCCC(C)O2)/C=C(C)/C=C/C(=O)[C@H](C)C1.CO |
| InChI | InChI=1S/C27H46O5.C2H6.CH4O/c1-6-8-24-15-21(3)13-14-30-31-19-25(18-29-27-10-7-9-23(5)32-27)16-20(2)11-12-26(28)22(4)17-24;2*1-2/h11-12,16,21-25,27H,6-10,13-15,17-19H2,1-5H3;1-2H3;2H,1H3/b12-11+,20-16+;;/t21-,22+,23?,24+,25?,27?;;/m0../s1 |
| InChIKey | ZHBGWPLDRLXGAM-UUIJCAILSA-N |
| XLogP | 7.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.77 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|