C18H30FNO — CID 156867915
ethane;2-[(1E,3E,5E,7E)-1-fluoro-9-methylideneundeca-1,3,5,7-tetraen-4-yl]oxy-N-methylpropan-1-amine (PubChem CID 156867915) has the molecular formula C18H30FNO and a molecular weight of 295.44 g/mol. Its IUPAC name is ethane;2-[(1E,3E,5E,7E)-1-fluoro-9-methylideneundeca-1,3,5,7-tetraen-4-yl]oxy-N-methylpropan-1-amine.
| Compound Name | ethane;2-[(1E,3E,5E,7E)-1-fluoro-9-methylideneundeca-1,3,5,7-tetraen-4-yl]oxy-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 156867915 |
| Molecular Formula | C18H30FNO |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | ethane;2-[(1E,3E,5E,7E)-1-fluoro-9-methylideneundeca-1,3,5,7-tetraen-4-yl]oxy-N-methylpropan-1-amine |
| SMILES | C=C(/C=C/C=C/C(=C\C=C\F)OC(C)CNC)CC.CC |
| InChI | InChI=1S/C16H24FNO.C2H6/c1-5-14(2)9-6-7-10-16(11-8-12-17)19-15(3)13-18-4;1-2/h6-12,15,18H,2,5,13H2,1,3-4H3;1-2H3/b9-6+,10-7+,12-8+,16-11+; |
| InChIKey | IQUVCHULZPFJQK-WHLDHSGCSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|