(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride

C6H7Cl2N — CID 156868272

IUPAC(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride
SMILESC=C/C=C(Cl)\C(Cl)=N\C
InChIInChI=1S/C6H7Cl2N/c1-3-4-5(7)6(8)9-2/h3-4H,1H2,2H3/b5-4+,9-6-
InChIKeyJGWYUEKSENLFIX-WEHQGULRSA-N
MW164.03 g/mol
LogP2.56
Rot. Bonds2

About (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride

(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride (PubChem CID 156868272) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride.

Molecular Properties

Compound Name(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride
PubChem CID156868272
Molecular FormulaC6H7Cl2N
Molecular Weight164.03 g/mol
Exact Mass163.00
IUPAC Name(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride
SMILESC=C/C=C(Cl)\C(Cl)=N\C
InChIInChI=1S/C6H7Cl2N/c1-3-4-5(7)6(8)9-2/h3-4H,1H2,2H3/b5-4+,9-6-
InChIKeyJGWYUEKSENLFIX-WEHQGULRSA-N
XLogP2.56
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.03
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The IUPAC name of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride (CID 156868272) is (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride.
What is the SMILES notation for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The canonical SMILES for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride is C=C/C=C(Cl)\C(Cl)=N\C.
What is the InChIKey of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The InChIKey is JGWYUEKSENLFIX-WEHQGULRSA-N. The full InChI is InChI=1S/C6H7Cl2N/c1-3-4-5(7)6(8)9-2/h3-4H,1H2,2H3/b5-4+,9-6-.
What are the key properties of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride has a molecular weight of 164.03 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride is sourced from PubChem (CID 156868272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).