About (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride
(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride (PubChem CID 156868272) has the molecular formula C6H7Cl2N
and a molecular weight of 164.03 g/mol. Its IUPAC name is (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride.
Molecular Properties
| Compound Name | (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride |
| PubChem CID | 156868272 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride |
| SMILES | C=C/C=C(Cl)\C(Cl)=N\C |
| InChI | InChI=1S/C6H7Cl2N/c1-3-4-5(7)6(8)9-2/h3-4H,1H2,2H3/b5-4+,9-6- |
| InChIKey | JGWYUEKSENLFIX-WEHQGULRSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The IUPAC name of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride (CID 156868272) is (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride.
What is the SMILES notation for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The canonical SMILES for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride is C=C/C=C(Cl)\C(Cl)=N\C.
What is the InChIKey of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
The InChIKey is JGWYUEKSENLFIX-WEHQGULRSA-N. The full InChI is InChI=1S/C6H7Cl2N/c1-3-4-5(7)6(8)9-2/h3-4H,1H2,2H3/b5-4+,9-6-.
What are the key properties of (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride?
(2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride has a molecular weight of 164.03 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-chloro-N-methylpenta-2,4-dienimidoyl chloride is sourced from PubChem (CID 156868272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).