About N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine
N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (PubChem CID 156868342) has the molecular formula C8H14N4OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
Molecular Properties
| Compound Name | N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| PubChem CID | 156868342 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| SMILES | CSNCC1(Cn2cncn2)COC1 |
| InChI | InChI=1S/C8H14N4OS/c1-14-11-2-8(4-13-5-8)3-12-7-9-6-10-12/h6-7,11H,2-5H2,1H3 |
| InChIKey | VMESBMBMNULAFN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The IUPAC name of N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (CID 156868342) is N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
What is the SMILES notation for N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The canonical SMILES for N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is CSNCC1(Cn2cncn2)COC1.
What is the InChIKey of N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The InChIKey is VMESBMBMNULAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4OS/c1-14-11-2-8(4-13-5-8)3-12-7-9-6-10-12/h6-7,11H,2-5H2,1H3.
What are the key properties of N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine has a molecular weight of 214.29 g/mol, XLogP of 0.16, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylsulfanyl-1-[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is sourced from PubChem (CID 156868342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).