About ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine
ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (PubChem CID 156868360) has the molecular formula C9H20N4O
and a molecular weight of 200.29 g/mol. Its IUPAC name is ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| PubChem CID | 156868360 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine |
| SMILES | CC.NCC1(Cn2cncn2)COC1.[H][H] |
| InChI | InChI=1S/C7H12N4O.C2H6.H2/c8-1-7(3-12-4-7)2-11-6-9-5-10-11;1-2;/h5-6H,1-4,8H2;1-2H3;1H |
| InChIKey | HITWEOLDYPUSOF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The IUPAC name of ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine (CID 156868360) is ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine.
What is the SMILES notation for ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The canonical SMILES for ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is CC.NCC1(Cn2cncn2)COC1.[H][H].
What is the InChIKey of ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
The InChIKey is HITWEOLDYPUSOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O.C2H6.H2/c8-1-7(3-12-4-7)2-11-6-9-5-10-11;1-2;/h5-6H,1-4,8H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine?
ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine has a molecular weight of 200.29 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methanamine is sourced from PubChem (CID 156868360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).