About [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten
[(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten (PubChem CID 156868549) has the molecular formula C11H19NOW
and a molecular weight of 365.12 g/mol. Its IUPAC name is [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten.
Molecular Properties
| Compound Name | [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten |
| PubChem CID | 156868549 |
| Molecular Formula | C11H19NOW |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten |
| SMILES | C/C=C/C=C\C(=[W])OCCCN(C)C |
| InChI | InChI=1S/C11H19NO.W/c1-4-5-6-7-10-13-11-8-9-12(2)3;/h4-7H,8-9,11H2,1-3H3;/b5-4+,7-6-; |
| InChIKey | XAGFMQJFHCDKPB-NDOZFENSSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten?
The IUPAC name of [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten (CID 156868549) is [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten.
What is the SMILES notation for [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten?
The canonical SMILES for [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten is C/C=C/C=C\C(=[W])OCCCN(C)C.
What is the InChIKey of [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten?
The InChIKey is XAGFMQJFHCDKPB-NDOZFENSSA-N. The full InChI is InChI=1S/C11H19NO.W/c1-4-5-6-7-10-13-11-8-9-12(2)3;/h4-7H,8-9,11H2,1-3H3;/b5-4+,7-6-;.
What are the key properties of [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten?
[(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten has a molecular weight of 365.12 g/mol, XLogP of 1.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z,4E)-1-[3-(dimethylamino)propoxy]hexa-2,4-dienylidene]tungsten is sourced from PubChem (CID 156868549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).