About [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium
[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium (PubChem CID 156868647) has the molecular formula C7H11N4OY-
and a molecular weight of 256.10 g/mol. Its IUPAC name is [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium.
Molecular Properties
| Compound Name | [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium |
| PubChem CID | 156868647 |
| Molecular Formula | C7H11N4OY- |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium |
| SMILES | [NH-]CC1(Cn2cncn2)COC1.[Y] |
| InChI | InChI=1S/C7H11N4O.Y/c8-1-7(3-12-4-7)2-11-6-9-5-10-11;/h5-6,8H,1-4H2;/q-1; |
| InChIKey | WNZZCUFFIHEYRC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium?
The IUPAC name of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium (CID 156868647) is [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium.
What is the SMILES notation for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium?
The canonical SMILES for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium is [NH-]CC1(Cn2cncn2)COC1.[Y].
What is the InChIKey of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium?
The InChIKey is WNZZCUFFIHEYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N4O.Y/c8-1-7(3-12-4-7)2-11-6-9-5-10-11;/h5-6,8H,1-4H2;/q-1;.
What are the key properties of [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium?
[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium has a molecular weight of 256.10 g/mol, XLogP of 0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methylazanide;yttrium is sourced from PubChem (CID 156868647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).