C16H8B2F4N6 — CID 156868761
CID 156868761 (PubChem CID 156868761) has the molecular formula C16H8B2F4N6 and a molecular weight of 381.90 g/mol.
| Compound Name | CID 156868761 |
|---|---|
| PubChem CID | 156868761 |
| Molecular Formula | C16H8B2F4N6 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | — |
| SMILES | [B]c1nc2c(Cc3ccccc3F)nc(-c3n[nH]c(C(F)(F)F)n3)cn2c1[B] |
| InChI | InChI=1S/C16H8B2F4N6/c17-11-12(18)28-6-10(13-25-15(27-26-13)16(20,21)22)23-9(14(28)24-11)5-7-3-1-2-4-8(7)19/h1-4,6H,5H2,(H,25,26,27) |
| InChIKey | TYDLHFFVVOAKDA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|