C6H5BN4O — CID 156868790
CID 156868790 (PubChem CID 156868790) has the molecular formula C6H5BN4O and a molecular weight of 159.94 g/mol.
| Compound Name | CID 156868790 |
|---|---|
| PubChem CID | 156868790 |
| Molecular Formula | C6H5BN4O |
| Molecular Weight | 159.94 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | — |
| SMILES | [B]c1nc2nc(C)cc(=O)n2[nH]1 |
| InChI | InChI=1S/C6H5BN4O/c1-3-2-4(12)11-6(8-3)9-5(7)10-11/h2H,1H3,(H,8,9,10) |
| InChIKey | ZRXBZJDIWHJHKD-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.94 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|