C25H39N3O7 — CID 156868976
(4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbut-2-enoyl]amino]-5-oxoheptanoic acid;propane (PubChem CID 156868976) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbut-2-enoyl]amino]-5-oxoheptanoic acid;propane.
| Compound Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbut-2-enoyl]amino]-5-oxoheptanoic acid;propane |
|---|---|
| PubChem CID | 156868976 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (4S)-4-[[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-3-methylbut-2-enoyl]amino]-5-oxoheptanoic acid;propane |
| SMILES | CCC.CCC(=O)[C@H](CCC(=O)O)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)=C(C)C |
| InChI | InChI=1S/C22H31N3O7.C3H8/c1-4-16(26)15(9-12-20(30)31)23-22(32)21(14(2)3)24-17(27)8-6-5-7-13-25-18(28)10-11-19(25)29;1-3-2/h10-11,15H,4-9,12-13H2,1-3H3,(H,23,32)(H,24,27)(H,30,31);3H2,1-2H3/t15-;/m0./s1 |
| InChIKey | DLIPEIREWMOPBW-RSAXXLAASA-N |
| XLogP | 2.63 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|