About 2-propan-2-yl-1,5-dihydrotetrazole
2-propan-2-yl-1,5-dihydrotetrazole (PubChem CID 156869134) has the molecular formula C4H10N4
and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-propan-2-yl-1,5-dihydrotetrazole.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,5-dihydrotetrazole |
| PubChem CID | 156869134 |
| Molecular Formula | C4H10N4 |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.09 |
| IUPAC Name | 2-propan-2-yl-1,5-dihydrotetrazole |
| SMILES | CC(C)N1N=NCN1 |
| InChI | InChI=1S/C4H10N4/c1-4(2)8-6-3-5-7-8/h4,6H,3H2,1-2H3 |
| InChIKey | IVAOWSSRHFKFFG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-1,5-dihydrotetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,5-dihydrotetrazole?
The IUPAC name of 2-propan-2-yl-1,5-dihydrotetrazole (CID 156869134) is 2-propan-2-yl-1,5-dihydrotetrazole.
What is the SMILES notation for 2-propan-2-yl-1,5-dihydrotetrazole?
The canonical SMILES for 2-propan-2-yl-1,5-dihydrotetrazole is CC(C)N1N=NCN1.
What is the InChIKey of 2-propan-2-yl-1,5-dihydrotetrazole?
The InChIKey is IVAOWSSRHFKFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4/c1-4(2)8-6-3-5-7-8/h4,6H,3H2,1-2H3.
What are the key properties of 2-propan-2-yl-1,5-dihydrotetrazole?
2-propan-2-yl-1,5-dihydrotetrazole has a molecular weight of 114.15 g/mol, XLogP of 0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,5-dihydrotetrazole is sourced from PubChem (CID 156869134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).