About 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen
1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen (PubChem CID 156869161) has the molecular formula C8H19NO2S
and a molecular weight of 193.31 g/mol. Its IUPAC name is 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen |
| PubChem CID | 156869161 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen |
| SMILES | CCNS(=O)(=O)CC1CCCC1.[H][H] |
| InChI | InChI=1S/C8H17NO2S.H2/c1-2-9-12(10,11)7-8-5-3-4-6-8;/h8-9H,2-7H2,1H3;1H |
| InChIKey | SAGKBKCCLGJGSW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The IUPAC name of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen (CID 156869161) is 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen.
What is the SMILES notation for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The canonical SMILES for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen is CCNS(=O)(=O)CC1CCCC1.[H][H].
What is the InChIKey of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The InChIKey is SAGKBKCCLGJGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S.H2/c1-2-9-12(10,11)7-8-5-3-4-6-8;/h8-9H,2-7H2,1H3;1H.
What are the key properties of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen has a molecular weight of 193.31 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen is sourced from PubChem (CID 156869161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).