1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen

C8H19NO2S — CID 156869161

IUPAC1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen
SMILESCCNS(=O)(=O)CC1CCCC1.[H][H]
InChIInChI=1S/C8H17NO2S.H2/c1-2-9-12(10,11)7-8-5-3-4-6-8;/h8-9H,2-7H2,1H3;1H
InChIKeySAGKBKCCLGJGSW-UHFFFAOYSA-N
MW193.31 g/mol
LogP1.36
Rot. Bonds4

About 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen

1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen (PubChem CID 156869161) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen.

Molecular Properties

Compound Name1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen
PubChem CID156869161
Molecular FormulaC8H19NO2S
Molecular Weight193.31 g/mol
Exact Mass193.11
IUPAC Name1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen
SMILESCCNS(=O)(=O)CC1CCCC1.[H][H]
InChIInChI=1S/C8H17NO2S.H2/c1-2-9-12(10,11)7-8-5-3-4-6-8;/h8-9H,2-7H2,1H3;1H
InChIKeySAGKBKCCLGJGSW-UHFFFAOYSA-N
XLogP1.36
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.31
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The IUPAC name of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen (CID 156869161) is 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen.
What is the SMILES notation for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The canonical SMILES for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen is CCNS(=O)(=O)CC1CCCC1.[H][H].
What is the InChIKey of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
The InChIKey is SAGKBKCCLGJGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S.H2/c1-2-9-12(10,11)7-8-5-3-4-6-8;/h8-9H,2-7H2,1H3;1H.
What are the key properties of 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen?
1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen has a molecular weight of 193.31 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-ethylmethanesulfonamide;molecular hydrogen is sourced from PubChem (CID 156869161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).