About 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile
4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile (PubChem CID 156870774) has the molecular formula C22H15FN2O3
and a molecular weight of 374.37 g/mol. Its IUPAC name is 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile |
| PubChem CID | 156870774 |
| Molecular Formula | C22H15FN2O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cc2ccnc(Oc3ccc4c(c3F)OCCC4=O)c2)cc1 |
| InChI | InChI=1S/C22H15FN2O3/c23-21-19(6-5-17-18(26)8-10-27-22(17)21)28-20-12-16(7-9-25-20)11-14-1-3-15(13-24)4-2-14/h1-7,9,12H,8,10-11H2 |
| InChIKey | BELSSYSDCPTSAJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile?
The IUPAC name of 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile (CID 156870774) is 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile.
What is the SMILES notation for 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile?
The canonical SMILES for 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile is N#Cc1ccc(Cc2ccnc(Oc3ccc4c(c3F)OCCC4=O)c2)cc1.
What is the InChIKey of 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile?
The InChIKey is BELSSYSDCPTSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15FN2O3/c23-21-19(6-5-17-18(26)8-10-27-22(17)21)28-20-12-16(7-9-25-20)11-14-1-3-15(13-24)4-2-14/h1-7,9,12H,8,10-11H2.
What are the key properties of 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile?
4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile has a molecular weight of 374.37 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(8-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzonitrile is sourced from PubChem (CID 156870774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).