About 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide
4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide (PubChem CID 156870782) has the molecular formula C22H17FN2O4
and a molecular weight of 392.39 g/mol. Its IUPAC name is 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide.
Molecular Properties
| Compound Name | 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide |
| PubChem CID | 156870782 |
| Molecular Formula | C22H17FN2O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide |
| SMILES | NC(=O)c1ccc(C(Oc2cc(F)c3c(c2)OCCC3=O)c2ccncc2)cc1 |
| InChI | InChI=1S/C22H17FN2O4/c23-17-11-16(12-19-20(17)18(26)7-10-28-19)29-21(14-5-8-25-9-6-14)13-1-3-15(4-2-13)22(24)27/h1-6,8-9,11-12,21H,7,10H2,(H2,24,27) |
| InChIKey | PUHCHPQAHKXWDX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide?
The IUPAC name of 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide (CID 156870782) is 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide.
What is the SMILES notation for 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide?
The canonical SMILES for 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide is NC(=O)c1ccc(C(Oc2cc(F)c3c(c2)OCCC3=O)c2ccncc2)cc1.
What is the InChIKey of 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide?
The InChIKey is PUHCHPQAHKXWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FN2O4/c23-17-11-16(12-19-20(17)18(26)7-10-28-19)29-21(14-5-8-25-9-6-14)13-1-3-15(4-2-13)22(24)27/h1-6,8-9,11-12,21H,7,10H2,(H2,24,27).
What are the key properties of 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide?
4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide has a molecular weight of 392.39 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-fluoro-4-oxo-2,3-dihydrochromen-7-yl)oxy-pyridin-4-ylmethyl]benzamide is sourced from PubChem (CID 156870782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).