About 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one
7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one (PubChem CID 156870785) has the molecular formula C18H18FNO3
and a molecular weight of 315.34 g/mol. Its IUPAC name is 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 156870785 |
| Molecular Formula | C18H18FNO3 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1cc(COc2c(F)cc3c(c2C)OCCC3=O)cc(C)n1 |
| InChI | InChI=1S/C18H18FNO3/c1-10-6-13(7-11(2)20-10)9-23-18-12(3)17-14(8-15(18)19)16(21)4-5-22-17/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | HDLRZSLHIKYZTA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one (CID 156870785) is 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one is Cc1cc(COc2c(F)cc3c(c2C)OCCC3=O)cc(C)n1.
What is the InChIKey of 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one?
The InChIKey is HDLRZSLHIKYZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO3/c1-10-6-13(7-11(2)20-10)9-23-18-12(3)17-14(8-15(18)19)16(21)4-5-22-17/h6-8H,4-5,9H2,1-3H3.
What are the key properties of 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one?
7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one has a molecular weight of 315.34 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,6-dimethyl-4-pyridinyl)methoxy]-6-fluoro-8-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 156870785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).