About 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide
4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide (PubChem CID 156870878) has the molecular formula C28H22N2O4
and a molecular weight of 450.49 g/mol. Its IUPAC name is 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide.
Molecular Properties
| Compound Name | 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide |
| PubChem CID | 156870878 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(Cc2ccnc(Oc3ccc4c(c3-c3ccccc3)OCCC4=O)c2)cc1 |
| InChI | InChI=1S/C28H22N2O4/c29-28(32)21-8-6-18(7-9-21)16-19-12-14-30-25(17-19)34-24-11-10-22-23(31)13-15-33-27(22)26(24)20-4-2-1-3-5-20/h1-12,14,17H,13,15-16H2,(H2,29,32) |
| InChIKey | DVKWKHWUXYMPGK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide?
The IUPAC name of 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide (CID 156870878) is 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide.
What is the SMILES notation for 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide?
The canonical SMILES for 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide is NC(=O)c1ccc(Cc2ccnc(Oc3ccc4c(c3-c3ccccc3)OCCC4=O)c2)cc1.
What is the InChIKey of 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide?
The InChIKey is DVKWKHWUXYMPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22N2O4/c29-28(32)21-8-6-18(7-9-21)16-19-12-14-30-25(17-19)34-24-11-10-22-23(31)13-15-33-27(22)26(24)20-4-2-1-3-5-20/h1-12,14,17H,13,15-16H2,(H2,29,32).
What are the key properties of 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide?
4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide has a molecular weight of 450.49 g/mol, XLogP of 5.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(4-oxo-8-phenyl-2,3-dihydrochromen-7-yl)oxy]-4-pyridinyl]methyl]benzamide is sourced from PubChem (CID 156870878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).