About 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile
3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile (PubChem CID 15687210) has the molecular formula C15H8N6O2
and a molecular weight of 304.27 g/mol. Its IUPAC name is 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile |
| PubChem CID | 15687210 |
| Molecular Formula | C15H8N6O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile |
| SMILES | N#CC(=C1C(=O)c2ccccc2C1=O)n1nc(N)c(C#N)c1N |
| InChI | InChI=1S/C15H8N6O2/c16-5-9-14(18)20-21(15(9)19)10(6-17)11-12(22)7-3-1-2-4-8(7)13(11)23/h1-4H,19H2,(H2,18,20) |
| InChIKey | OLBNBTNSGGFKDJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile?
The IUPAC name of 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile (CID 15687210) is 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile.
What is the SMILES notation for 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile?
The canonical SMILES for 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile is N#CC(=C1C(=O)c2ccccc2C1=O)n1nc(N)c(C#N)c1N.
What is the InChIKey of 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile?
The InChIKey is OLBNBTNSGGFKDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N6O2/c16-5-9-14(18)20-21(15(9)19)10(6-17)11-12(22)7-3-1-2-4-8(7)13(11)23/h1-4H,19H2,(H2,18,20).
What are the key properties of 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile?
3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile has a molecular weight of 304.27 g/mol, XLogP of 0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-1-[cyano-(1,3-dioxoinden-2-ylidene)methyl]pyrazole-4-carbonitrile is sourced from PubChem (CID 15687210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).