C17H28F2N3O+ — CID 156872312
N-[[(3R)-6,6-dimethyloxan-3-yl]methyl]-N-ethyl-5,6-difluoro-1-propylpyrimidin-1-ium-4-amine (PubChem CID 156872312) has the molecular formula C17H28F2N3O+ and a molecular weight of 328.43 g/mol. Its IUPAC name is N-[[(3R)-6,6-dimethyloxan-3-yl]methyl]-N-ethyl-5,6-difluoro-1-propylpyrimidin-1-ium-4-amine.
| Compound Name | N-[[(3R)-6,6-dimethyloxan-3-yl]methyl]-N-ethyl-5,6-difluoro-1-propylpyrimidin-1-ium-4-amine |
|---|---|
| PubChem CID | 156872312 |
| Molecular Formula | C17H28F2N3O+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[[(3R)-6,6-dimethyloxan-3-yl]methyl]-N-ethyl-5,6-difluoro-1-propylpyrimidin-1-ium-4-amine |
| SMILES | CCC[n+]1cnc(N(CC)C[C@H]2CCC(C)(C)OC2)c(F)c1F |
| InChI | InChI=1S/C17H28F2N3O/c1-5-9-22-12-20-16(14(18)15(22)19)21(6-2)10-13-7-8-17(3,4)23-11-13/h12-13H,5-11H2,1-4H3/q+1/t13-/m1/s1 |
| InChIKey | SSHZTQRGZYZLFI-CYBMUJFWSA-N |
| XLogP | 3.09 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|