About (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid
(3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 156872365) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 156872365 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | [H]/N=C1\C(OC)=CC(C(=O)O)=C\C1=C\C(C)=N\[H] |
| InChI | InChI=1S/C11H12N2O3/c1-6(12)3-7-4-8(11(14)15)5-9(16-2)10(7)13/h3-5,12-13H,1-2H3,(H,14,15)/b7-3-,12-6+,13-10- |
| InChIKey | LCNYIQAWLFGCST-COYTYCBRSA-N |
| XLogP | 1.53 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid (CID 156872365) is (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid is [H]/N=C1\C(OC)=CC(C(=O)O)=C\C1=C\C(C)=N\[H].
What is the InChIKey of (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is LCNYIQAWLFGCST-COYTYCBRSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-6(12)3-7-4-8(11(14)15)5-9(16-2)10(7)13/h3-5,12-13H,1-2H3,(H,14,15)/b7-3-,12-6+,13-10-.
What are the key properties of (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid?
(3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 220.23 g/mol, XLogP of 1.53, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-imino-3-(2-iminopropylidene)-5-methoxycyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 156872365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).