C17H14F4INO2 — CID 156872788
2,2,2-trifluoro-1-[7-(4-fluorophenyl)-3-(iodomethyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]ethanol (PubChem CID 156872788) has the molecular formula C17H14F4INO2 and a molecular weight of 467.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[7-(4-fluorophenyl)-3-(iodomethyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[7-(4-fluorophenyl)-3-(iodomethyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]ethanol |
|---|---|
| PubChem CID | 156872788 |
| Molecular Formula | C17H14F4INO2 |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2,2,2-trifluoro-1-[7-(4-fluorophenyl)-3-(iodomethyl)-3-methyl-2H-furo[2,3-c]pyridin-5-yl]ethanol |
| SMILES | CC1(CI)COc2c1cc(C(O)C(F)(F)F)nc2-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F4INO2/c1-16(7-22)8-25-14-11(16)6-12(15(24)17(19,20)21)23-13(14)9-2-4-10(18)5-3-9/h2-6,15,24H,7-8H2,1H3 |
| InChIKey | GNUFAJWLTNSJJB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|