C30H26F5N3O3 — CID 156872868
N-[3,3,3-trifluoro-2-[3-(fluoromethyl)-8-(4-fluorophenyl)-3,4-dimethyl-2,4-dihydropyrano[2,3-c]pyridin-6-yl]-2-hydroxypropyl]quinoline-6-carboxamide (PubChem CID 156872868) has the molecular formula C30H26F5N3O3 and a molecular weight of 571.55 g/mol. Its IUPAC name is N-[3,3,3-trifluoro-2-[3-(fluoromethyl)-8-(4-fluorophenyl)-3,4-dimethyl-2,4-dihydropyrano[2,3-c]pyridin-6-yl]-2-hydroxypropyl]quinoline-6-carboxamide.
| Compound Name | N-[3,3,3-trifluoro-2-[3-(fluoromethyl)-8-(4-fluorophenyl)-3,4-dimethyl-2,4-dihydropyrano[2,3-c]pyridin-6-yl]-2-hydroxypropyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 156872868 |
| Molecular Formula | C30H26F5N3O3 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | N-[3,3,3-trifluoro-2-[3-(fluoromethyl)-8-(4-fluorophenyl)-3,4-dimethyl-2,4-dihydropyrano[2,3-c]pyridin-6-yl]-2-hydroxypropyl]quinoline-6-carboxamide |
| SMILES | CC1c2cc(C(O)(CNC(=O)c3ccc4ncccc4c3)C(F)(F)F)nc(-c3ccc(F)cc3)c2OCC1(C)CF |
| InChI | InChI=1S/C30H26F5N3O3/c1-17-22-13-24(38-25(18-5-8-21(32)9-6-18)26(22)41-16-28(17,2)14-31)29(40,30(33,34)35)15-37-27(39)20-7-10-23-19(12-20)4-3-11-36-23/h3-13,17,40H,14-16H2,1-2H3,(H,37,39) |
| InChIKey | JOBNNOZONLZBOC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |