C30H26F6N4O3 — CID 156873029
N-[2-[3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]-2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 156873029) has the molecular formula C30H26F6N4O3 and a molecular weight of 604.55 g/mol. Its IUPAC name is N-[2-[3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]-2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[2-[3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]-2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 156873029 |
| Molecular Formula | C30H26F6N4O3 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | N-[2-[3,3-bis(fluoromethyl)-7-(4-fluorophenyl)-2H-furo[2,3-c]pyridin-5-yl]-3,3,3-trifluoropropyl]-2-cyclopropyl-8-methoxyimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | COc1cc(C(=O)NCC(c2cc3c(c(-c4ccc(F)cc4)n2)OCC3(CF)CF)C(F)(F)F)cn2cc(C3CC3)nc12 |
| InChI | InChI=1S/C30H26F6N4O3/c1-42-24-8-18(11-40-12-23(16-2-3-16)39-27(24)40)28(41)37-10-21(30(34,35)36)22-9-20-26(43-15-29(20,13-31)14-32)25(38-22)17-4-6-19(33)7-5-17/h4-9,11-12,16,21H,2-3,10,13-15H2,1H3,(H,37,41) |
| InChIKey | ATTYYBSQBYZWTL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |