C8H14O3 — CID 156874453
(1S)-1-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]ethanol (PubChem CID 156874453) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (1S)-1-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]ethanol.
| Compound Name | (1S)-1-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]ethanol |
|---|---|
| PubChem CID | 156874453 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (1S)-1-[(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]ethanol |
| SMILES | C[C@H](O)C1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C8H14O3/c1-5(9)6-4-11-7-2-3-10-8(6)7/h5-9H,2-4H2,1H3/t5-,6?,7+,8+/m0/s1 |
| InChIKey | YYYGUBDOGZOYOV-KTGGKTQHSA-N |
| XLogP | 0.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |