About 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one
1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one (PubChem CID 156874513) has the molecular formula C11H16FNO
and a molecular weight of 197.25 g/mol. Its IUPAC name is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one.
Molecular Properties
| Compound Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one |
| PubChem CID | 156874513 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one |
| SMILES | CNCCCC(=O)C1=CCC(F)C=C1 |
| InChI | InChI=1S/C11H16FNO/c1-13-8-2-3-11(14)9-4-6-10(12)7-5-9/h4-6,10,13H,2-3,7-8H2,1H3 |
| InChIKey | NQIOHGYYGQXJNI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one?
The IUPAC name of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one (CID 156874513) is 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one.
What is the SMILES notation for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one?
The canonical SMILES for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one is CNCCCC(=O)C1=CCC(F)C=C1.
What is the InChIKey of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one?
The InChIKey is NQIOHGYYGQXJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FNO/c1-13-8-2-3-11(14)9-4-6-10(12)7-5-9/h4-6,10,13H,2-3,7-8H2,1H3.
What are the key properties of 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one?
1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one has a molecular weight of 197.25 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorocyclohexa-1,5-dien-1-yl)-4-(methylamino)butan-1-one is sourced from PubChem (CID 156874513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).