C24H32ClN3O2 — CID 156874711
[4-(4-aminopiperidin-1-yl)-2-chlorophenyl]-(2-phenylmorpholin-4-yl)methanone;ethane (PubChem CID 156874711) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is [4-(4-aminopiperidin-1-yl)-2-chlorophenyl]-(2-phenylmorpholin-4-yl)methanone;ethane.
| Compound Name | [4-(4-aminopiperidin-1-yl)-2-chlorophenyl]-(2-phenylmorpholin-4-yl)methanone;ethane |
|---|---|
| PubChem CID | 156874711 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [4-(4-aminopiperidin-1-yl)-2-chlorophenyl]-(2-phenylmorpholin-4-yl)methanone;ethane |
| SMILES | CC.NC1CCN(c2ccc(C(=O)N3CCOC(c4ccccc4)C3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H26ClN3O2.C2H6/c23-20-14-18(25-10-8-17(24)9-11-25)6-7-19(20)22(27)26-12-13-28-21(15-26)16-4-2-1-3-5-16;1-2/h1-7,14,17,21H,8-13,15,24H2;1-2H3 |
| InChIKey | VELVUVAKWUSQGI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |