C28H58N2O3 — CID 156874788
N-(6-acetamido-2,4,4-trimethylhexyl)-2-methylbutanamide;2-methylbut-1-ene;4-methylhexan-2-ol (PubChem CID 156874788) has the molecular formula C28H58N2O3 and a molecular weight of 470.78 g/mol. Its IUPAC name is N-(6-acetamido-2,4,4-trimethylhexyl)-2-methylbutanamide;2-methylbut-1-ene;4-methylhexan-2-ol.
| Compound Name | N-(6-acetamido-2,4,4-trimethylhexyl)-2-methylbutanamide;2-methylbut-1-ene;4-methylhexan-2-ol |
|---|---|
| PubChem CID | 156874788 |
| Molecular Formula | C28H58N2O3 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 470.44 |
| IUPAC Name | N-(6-acetamido-2,4,4-trimethylhexyl)-2-methylbutanamide;2-methylbut-1-ene;4-methylhexan-2-ol |
| SMILES | C=C(C)CC.CCC(C)C(=O)NCC(C)CC(C)(C)CCNC(C)=O.CCC(C)CC(C)O |
| InChI | InChI=1S/C16H32N2O2.C7H16O.C5H10/c1-7-13(3)15(20)18-11-12(2)10-16(5,6)8-9-17-14(4)19;1-4-6(2)5-7(3)8;1-4-5(2)3/h12-13H,7-11H2,1-6H3,(H,17,19)(H,18,20);6-8H,4-5H2,1-3H3;2,4H2,1,3H3 |
| InChIKey | DCYTXBIHJPNUKU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|