C20H14F6N6O — CID 156875085
(E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydro-1,2,4-triazol-2-yl]-2-(1H-indazol-6-yl)prop-2-enamide (PubChem CID 156875085) has the molecular formula C20H14F6N6O and a molecular weight of 468.36 g/mol. Its IUPAC name is (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydro-1,2,4-triazol-2-yl]-2-(1H-indazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydro-1,2,4-triazol-2-yl]-2-(1H-indazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 156875085 |
| Molecular Formula | C20H14F6N6O |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydro-1,2,4-triazol-2-yl]-2-(1H-indazol-6-yl)prop-2-enamide |
| SMILES | NC(=O)/C(=C/N1CN=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)N1)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C20H14F6N6O/c21-19(22,23)13-3-12(4-14(6-13)20(24,25)26)18-28-9-32(31-18)8-15(17(27)33)10-1-2-11-7-29-30-16(11)5-10/h1-8H,9H2,(H2,27,33)(H,28,31)(H,29,30)/b15-8+ |
| InChIKey | KTWYPJYVVGCQSU-OVCLIPMQSA-N |
| XLogP | 3.65 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|