C21H14F6N7O+ — CID 156875093
[[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]-quinoxalin-2-ylazanium (PubChem CID 156875093) has the molecular formula C21H14F6N7O+ and a molecular weight of 494.38 g/mol. Its IUPAC name is [[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]-quinoxalin-2-ylazanium.
| Compound Name | [[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]-quinoxalin-2-ylazanium |
|---|---|
| PubChem CID | 156875093 |
| Molecular Formula | C21H14F6N7O+ |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [[(Z)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]amino]-quinoxalin-2-ylazanium |
| SMILES | O=C(/C=C\n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)N[NH2+]c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H13F6N7O/c22-20(23,24)13-7-12(8-14(9-13)21(25,26)27)19-29-11-34(33-19)6-5-18(35)32-31-17-10-28-15-3-1-2-4-16(15)30-17/h1-11H,(H,30,31)(H,32,35)/p+1/b6-5- |
| InChIKey | HEDCILIVHIGHMU-WAYWQWQTSA-O |
| XLogP | 3.32 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|