About ethane;5-methylsulfonylfuro[2,3-b]pyridine
ethane;5-methylsulfonylfuro[2,3-b]pyridine (PubChem CID 156875738) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is ethane;5-methylsulfonylfuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | ethane;5-methylsulfonylfuro[2,3-b]pyridine |
| PubChem CID | 156875738 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | ethane;5-methylsulfonylfuro[2,3-b]pyridine |
| SMILES | CC.CS(=O)(=O)c1cnc2occc2c1 |
| InChI | InChI=1S/C8H7NO3S.C2H6/c1-13(10,11)7-4-6-2-3-12-8(6)9-5-7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | KHPSNPHASMBACT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-methylsulfonylfuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylsulfonylfuro[2,3-b]pyridine?
The IUPAC name of ethane;5-methylsulfonylfuro[2,3-b]pyridine (CID 156875738) is ethane;5-methylsulfonylfuro[2,3-b]pyridine.
What is the SMILES notation for ethane;5-methylsulfonylfuro[2,3-b]pyridine?
The canonical SMILES for ethane;5-methylsulfonylfuro[2,3-b]pyridine is CC.CS(=O)(=O)c1cnc2occc2c1.
What is the InChIKey of ethane;5-methylsulfonylfuro[2,3-b]pyridine?
The InChIKey is KHPSNPHASMBACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S.C2H6/c1-13(10,11)7-4-6-2-3-12-8(6)9-5-7;1-2/h2-5H,1H3;1-2H3.
What are the key properties of ethane;5-methylsulfonylfuro[2,3-b]pyridine?
ethane;5-methylsulfonylfuro[2,3-b]pyridine has a molecular weight of 227.28 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylsulfonylfuro[2,3-b]pyridine is sourced from PubChem (CID 156875738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).